C24H17BrClNO4 — CID 129156145
methyl (1S,9R,10S,11R)-9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene-11-carboxylate (PubChem CID 129156145) has the molecular formula C24H17BrClNO4 and a molecular weight of 498.76 g/mol. Its IUPAC name is methyl (1S,9R,10S,11R)-9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene-11-carboxylate.
| Compound Name | methyl (1S,9R,10S,11R)-9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 129156145 |
| Molecular Formula | C24H17BrClNO4 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | methyl (1S,9R,10S,11R)-9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene-11-carboxylate |
| SMILES | COC(=O)[C@H]1C2O[C@@]23c2ncc(Cl)cc2O[C@@]3(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H17BrClNO4/c1-29-22(28)18-19(13-5-3-2-4-6-13)23(14-7-9-15(25)10-8-14)24(21(18)31-24)20-17(30-23)11-16(26)12-27-20/h2-12,18-19,21H,1H3/t18-,19-,21?,23+,24+/m1/s1 |
| InChIKey | MAYCUBREYXIRHL-NBEFMUFLSA-N |
| XLogP | 4.97 |
| TPSA | 60.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|