C25H29N7O — CID 129139971
7-methyl-2-(2-propan-2-ylphenyl)-9-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]purin-8-one (PubChem CID 129139971) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 7-methyl-2-(2-propan-2-ylphenyl)-9-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]purin-8-one.
| Compound Name | 7-methyl-2-(2-propan-2-ylphenyl)-9-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]purin-8-one |
|---|---|
| PubChem CID | 129139971 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 7-methyl-2-(2-propan-2-ylphenyl)-9-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]purin-8-one |
| SMILES | CC(C)c1ccccc1-c1ncc2c(n1)n(CC1CCN(c3ncccn3)CC1)c(=O)n2C |
| InChI | InChI=1S/C25H29N7O/c1-17(2)19-7-4-5-8-20(19)22-28-15-21-23(29-22)32(25(33)30(21)3)16-18-9-13-31(14-10-18)24-26-11-6-12-27-24/h4-8,11-12,15,17-18H,9-10,13-14,16H2,1-3H3 |
| InChIKey | ILWYHNJILKTEJD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |