C26H24N6O — CID 139452493
7-methyl-2-(2-propan-2-ylphenyl)-9-[(4-pyrazin-2-ylphenyl)methyl]purin-8-one (PubChem CID 139452493) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is 7-methyl-2-(2-propan-2-ylphenyl)-9-[(4-pyrazin-2-ylphenyl)methyl]purin-8-one.
| Compound Name | 7-methyl-2-(2-propan-2-ylphenyl)-9-[(4-pyrazin-2-ylphenyl)methyl]purin-8-one |
|---|---|
| PubChem CID | 139452493 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 7-methyl-2-(2-propan-2-ylphenyl)-9-[(4-pyrazin-2-ylphenyl)methyl]purin-8-one |
| SMILES | CC(C)c1ccccc1-c1ncc2c(n1)n(Cc1ccc(-c3cnccn3)cc1)c(=O)n2C |
| InChI | InChI=1S/C26H24N6O/c1-17(2)20-6-4-5-7-21(20)24-29-15-23-25(30-24)32(26(33)31(23)3)16-18-8-10-19(11-9-18)22-14-27-12-13-28-22/h4-15,17H,16H2,1-3H3 |
| InChIKey | KIKDOUAZBOMJHZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |