C24H25N5O3 — CID 129139446
methyl-[4-[[7-methyl-8-oxo-2-(2-propan-2-ylphenyl)purin-9-yl]methyl]phenyl]carbamic acid (PubChem CID 129139446) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is methyl-[4-[[7-methyl-8-oxo-2-(2-propan-2-ylphenyl)purin-9-yl]methyl]phenyl]carbamic acid.
| Compound Name | methyl-[4-[[7-methyl-8-oxo-2-(2-propan-2-ylphenyl)purin-9-yl]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 129139446 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | methyl-[4-[[7-methyl-8-oxo-2-(2-propan-2-ylphenyl)purin-9-yl]methyl]phenyl]carbamic acid |
| SMILES | CC(C)c1ccccc1-c1ncc2c(n1)n(Cc1ccc(N(C)C(=O)O)cc1)c(=O)n2C |
| InChI | InChI=1S/C24H25N5O3/c1-15(2)18-7-5-6-8-19(18)21-25-13-20-22(26-21)29(23(30)28(20)4)14-16-9-11-17(12-10-16)27(3)24(31)32/h5-13,15H,14H2,1-4H3,(H,31,32) |
| InChIKey | NZMVNZKTDLLHEC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |