C9H14F3N — CID 129140487
(1Z,3E)-N,4-dimethyl-3-(trifluoromethyl)hexa-1,3-dien-1-amine (PubChem CID 129140487) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (1Z,3E)-N,4-dimethyl-3-(trifluoromethyl)hexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,4-dimethyl-3-(trifluoromethyl)hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129140487 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1Z,3E)-N,4-dimethyl-3-(trifluoromethyl)hexa-1,3-dien-1-amine |
| SMILES | CC/C(C)=C(\C=C/NC)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-4-7(2)8(5-6-13-3)9(10,11)12/h5-6,13H,4H2,1-3H3/b6-5-,8-7+ |
| InChIKey | NFONMSILZSVRHL-IGTJQSIKSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|