C27H25Cl2N3O6S — CID 129141648
(2S)-2-[[5,7-dichloro-2-(2,3,6,7-tetrahydro-1-benzofuran-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 129141648) has the molecular formula C27H25Cl2N3O6S and a molecular weight of 590.49 g/mol. Its IUPAC name is (2S)-2-[[5,7-dichloro-2-(2,3,6,7-tetrahydro-1-benzofuran-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | (2S)-2-[[5,7-dichloro-2-(2,3,6,7-tetrahydro-1-benzofuran-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 129141648 |
| Molecular Formula | C27H25Cl2N3O6S |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | (2S)-2-[[5,7-dichloro-2-(2,3,6,7-tetrahydro-1-benzofuran-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | O=C(NC[C@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C(=O)C1C=CC3=C(C1)OCC3)C2)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C27H25Cl2N3O6S/c28-18-10-16-13-32(26(35)15-4-3-14-6-8-38-20(14)11-15)7-5-17(16)23(29)22(18)25(34)31-19(27(36)37)12-30-24(33)21-2-1-9-39-21/h1-4,9-10,15,19H,5-8,11-13H2,(H,30,33)(H,31,34)(H,36,37)/t15?,19-/m0/s1 |
| InChIKey | AVMMXNNOYRKPML-FUBQLUNQSA-N |
| XLogP | 3.80 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |