C26H25ClIN3O3S — CID 155031092
(2S)-2-[(2-benzyl-5-chloro-7-methyl-3,4-dihydro-1H-isoquinoline-6-carbonyl)amino]-3-(thiophene-2-carbonylamino)propanoyl iodide (PubChem CID 155031092) has the molecular formula C26H25ClIN3O3S and a molecular weight of 621.93 g/mol. Its IUPAC name is (2S)-2-[(2-benzyl-5-chloro-7-methyl-3,4-dihydro-1H-isoquinoline-6-carbonyl)amino]-3-(thiophene-2-carbonylamino)propanoyl iodide.
| Compound Name | (2S)-2-[(2-benzyl-5-chloro-7-methyl-3,4-dihydro-1H-isoquinoline-6-carbonyl)amino]-3-(thiophene-2-carbonylamino)propanoyl iodide |
|---|---|
| PubChem CID | 155031092 |
| Molecular Formula | C26H25ClIN3O3S |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.03 |
| IUPAC Name | (2S)-2-[(2-benzyl-5-chloro-7-methyl-3,4-dihydro-1H-isoquinoline-6-carbonyl)amino]-3-(thiophene-2-carbonylamino)propanoyl iodide |
| SMILES | Cc1cc2c(c(Cl)c1C(=O)N[C@@H](CNC(=O)c1cccs1)C(=O)I)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H25ClIN3O3S/c1-16-12-18-15-31(14-17-6-3-2-4-7-17)10-9-19(18)23(27)22(16)26(34)30-20(24(28)32)13-29-25(33)21-8-5-11-35-21/h2-8,11-12,20H,9-10,13-15H2,1H3,(H,29,33)(H,30,34)/t20-/m0/s1 |
| InChIKey | JSZQWRDTZFRRLP-FQEVSTJZSA-N |
| XLogP | 4.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|