C47H32N4O — CID 129142390
2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]indeno[1,2-b]carbazol-11-yl]phenol (PubChem CID 129142390) has the molecular formula C47H32N4O and a molecular weight of 668.80 g/mol. Its IUPAC name is 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]indeno[1,2-b]carbazol-11-yl]phenol.
| Compound Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]indeno[1,2-b]carbazol-11-yl]phenol |
|---|---|
| PubChem CID | 129142390 |
| Molecular Formula | C47H32N4O |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]indeno[1,2-b]carbazol-11-yl]phenol |
| SMILES | C#C/C=C\C=C/CC1(c2ccccc2O)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C47H32N4O/c1-2-3-4-5-18-29-47(39-26-15-17-28-43(39)52)38-25-14-12-23-34(38)36-31-42-37(30-40(36)47)35-24-13-16-27-41(35)51(42)46-49-44(32-19-8-6-9-20-32)48-45(50-46)33-21-10-7-11-22-33/h1,3-28,30-31,52H,29H2/b4-3-,18-5- |
| InChIKey | XEJRPWRTXJFBAT-JXRCCVACSA-N |
| XLogP | 10.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|