C37H47FO6 — CID 129143354
(2S)-5-[3-cyclopropyl-5-[[7-[4-(dihydroxymethyl)-4-methylcyclohexyl]-5-oxaspiro[3.4]oct-6-en-2-yl]methyl]-2-(4-fluorophenyl)phenoxy]-2-methylpentanoic acid (PubChem CID 129143354) has the molecular formula C37H47FO6 and a molecular weight of 606.78 g/mol. Its IUPAC name is (2S)-5-[3-cyclopropyl-5-[[7-[4-(dihydroxymethyl)-4-methylcyclohexyl]-5-oxaspiro[3.4]oct-6-en-2-yl]methyl]-2-(4-fluorophenyl)phenoxy]-2-methylpentanoic acid.
| Compound Name | (2S)-5-[3-cyclopropyl-5-[[7-[4-(dihydroxymethyl)-4-methylcyclohexyl]-5-oxaspiro[3.4]oct-6-en-2-yl]methyl]-2-(4-fluorophenyl)phenoxy]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 129143354 |
| Molecular Formula | C37H47FO6 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | (2S)-5-[3-cyclopropyl-5-[[7-[4-(dihydroxymethyl)-4-methylcyclohexyl]-5-oxaspiro[3.4]oct-6-en-2-yl]methyl]-2-(4-fluorophenyl)phenoxy]-2-methylpentanoic acid |
| SMILES | C[C@@H](CCCOc1cc(CC2CC3(CC(C4CCC(C)(C(O)O)CC4)=CO3)C2)cc(C2CC2)c1-c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C37H47FO6/c1-23(34(39)40)4-3-15-43-32-18-24(17-31(27-5-6-27)33(32)28-7-9-30(38)10-8-28)16-25-19-37(20-25)21-29(22-44-37)26-11-13-36(2,14-12-26)35(41)42/h7-10,17-18,22-23,25-27,35,41-42H,3-6,11-16,19-21H2,1-2H3,(H,39,40)/t23-,25?,26?,36?,37?/m0/s1 |
| InChIKey | SBSCUTIDBSSPKQ-JNWNFQHZSA-N |
| XLogP | 7.75 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|