C17H23NO — CID 129144785
(2E)-2-(anilinomethylidene)-5,5-dimethyl-3-methylideneheptanal (PubChem CID 129144785) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (2E)-2-(anilinomethylidene)-5,5-dimethyl-3-methylideneheptanal.
| Compound Name | (2E)-2-(anilinomethylidene)-5,5-dimethyl-3-methylideneheptanal |
|---|---|
| PubChem CID | 129144785 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2E)-2-(anilinomethylidene)-5,5-dimethyl-3-methylideneheptanal |
| SMILES | C=C(CC(C)(C)CC)/C(C=O)=C\Nc1ccccc1 |
| InChI | InChI=1S/C17H23NO/c1-5-17(3,4)11-14(2)15(13-19)12-18-16-9-7-6-8-10-16/h6-10,12-13,18H,2,5,11H2,1,3-4H3/b15-12- |
| InChIKey | KEERBNZZWDADNR-QINSGFPZSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|