C20H18N2O4 — CID 129147473
5-hydroxy-2-methyl-6-oxo-1-[2-(4-phenylphenyl)ethyl]pyrimidine-4-carboxylic acid (PubChem CID 129147473) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-6-oxo-1-[2-(4-phenylphenyl)ethyl]pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-2-methyl-6-oxo-1-[2-(4-phenylphenyl)ethyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 129147473 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 5-hydroxy-2-methyl-6-oxo-1-[2-(4-phenylphenyl)ethyl]pyrimidine-4-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(O)c(=O)n1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-13-21-17(20(25)26)18(23)19(24)22(13)12-11-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-10,23H,11-12H2,1H3,(H,25,26) |
| InChIKey | STEIMIUCQIOTJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |