C20H19FN2O — CID 46849277
2-(4-fluorophenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one (PubChem CID 46849277) has the molecular formula C20H19FN2O and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 46849277 |
| Molecular Formula | C20H19FN2O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-(4-fluorophenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one |
| SMILES | Cc1nc(-c2ccc(F)cc2)n(CCc2ccccc2)c(=O)c1C |
| InChI | InChI=1S/C20H19FN2O/c1-14-15(2)22-19(17-8-10-18(21)11-9-17)23(20(14)24)13-12-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | QMUOLNGJUUVHGN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |