C24H27FN2O2 — CID 68929895
2-(2-fluoro-3-methoxyphenyl)-6-methyl-5-(2-methylpropyl)-3-(2-phenylethyl)pyrimidin-4-one (PubChem CID 68929895) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-6-methyl-5-(2-methylpropyl)-3-(2-phenylethyl)pyrimidin-4-one.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-6-methyl-5-(2-methylpropyl)-3-(2-phenylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 68929895 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-6-methyl-5-(2-methylpropyl)-3-(2-phenylethyl)pyrimidin-4-one |
| SMILES | COc1cccc(-c2nc(C)c(CC(C)C)c(=O)n2CCc2ccccc2)c1F |
| InChI | InChI=1S/C24H27FN2O2/c1-16(2)15-20-17(3)26-23(19-11-8-12-21(29-4)22(19)25)27(24(20)28)14-13-18-9-6-5-7-10-18/h5-12,16H,13-15H2,1-4H3 |
| InChIKey | FBVDEXBSKIRPQS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |