C23H19FN2O3 — CID 135401163
3-[2-(3-fluorophenyl)ethyl]-2-(2-hydroxyphenyl)-8-methoxyquinazolin-4-one (PubChem CID 135401163) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethyl]-2-(2-hydroxyphenyl)-8-methoxyquinazolin-4-one.
| Compound Name | 3-[2-(3-fluorophenyl)ethyl]-2-(2-hydroxyphenyl)-8-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 135401163 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethyl]-2-(2-hydroxyphenyl)-8-methoxyquinazolin-4-one |
| SMILES | COc1cccc2c(=O)n(CCc3cccc(F)c3)c(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C23H19FN2O3/c1-29-20-11-5-9-18-21(20)25-22(17-8-2-3-10-19(17)27)26(23(18)28)13-12-15-6-4-7-16(24)14-15/h2-11,14,27H,12-13H2,1H3 |
| InChIKey | MPBKFGDZYDJZNX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |