C28H28FN3O — CID 174573403
2-(3-benzyl-2-fluorophenyl)-5-(dimethylamino)-6-methyl-3-(2-phenylethyl)pyrimidin-4-one (PubChem CID 174573403) has the molecular formula C28H28FN3O and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-(3-benzyl-2-fluorophenyl)-5-(dimethylamino)-6-methyl-3-(2-phenylethyl)pyrimidin-4-one.
| Compound Name | 2-(3-benzyl-2-fluorophenyl)-5-(dimethylamino)-6-methyl-3-(2-phenylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 174573403 |
| Molecular Formula | C28H28FN3O |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-(3-benzyl-2-fluorophenyl)-5-(dimethylamino)-6-methyl-3-(2-phenylethyl)pyrimidin-4-one |
| SMILES | Cc1nc(-c2cccc(Cc3ccccc3)c2F)n(CCc2ccccc2)c(=O)c1N(C)C |
| InChI | InChI=1S/C28H28FN3O/c1-20-26(31(2)3)28(33)32(18-17-21-11-6-4-7-12-21)27(30-20)24-16-10-15-23(25(24)29)19-22-13-8-5-9-14-22/h4-16H,17-19H2,1-3H3 |
| InChIKey | PZZHZXJEBFVACJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |