C14H19NS — CID 129149292
2-(5-hexylthiophen-2-yl)-1H-pyrrole (PubChem CID 129149292) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-(5-hexylthiophen-2-yl)-1H-pyrrole.
| Compound Name | 2-(5-hexylthiophen-2-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 129149292 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(5-hexylthiophen-2-yl)-1H-pyrrole |
| SMILES | CCCCCCc1ccc(-c2ccc[nH]2)s1 |
| InChI | InChI=1S/C14H19NS/c1-2-3-4-5-7-12-9-10-14(16-12)13-8-6-11-15-13/h6,8-11,15H,2-5,7H2,1H3 |
| InChIKey | NHOLJVBVRPZUHZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|