C15H28N2O — CID 129149585
1-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol (PubChem CID 129149585) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 129149585 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol |
| SMILES | CN1C[C@H]2CN(CC3(O)CCCCC3)C[C@@]2(C)C1 |
| InChI | InChI=1S/C15H28N2O/c1-14-10-16(2)8-13(14)9-17(11-14)12-15(18)6-4-3-5-7-15/h13,18H,3-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | SMORTQTYRJMJAV-UONOGXRCSA-N |
| XLogP | 1.57 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |