C14H26N2O — CID 118534899
1-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol (PubChem CID 118534899) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 118534899 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]cyclohexan-1-ol |
| SMILES | CN1C[C@@H]2CN(CC3(O)CCCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H26N2O/c1-15-7-12-9-16(10-13(12)8-15)11-14(17)5-3-2-4-6-14/h12-13,17H,2-11H2,1H3/t12-,13+ |
| InChIKey | MHFXXVYJJRXFGI-BETUJISGSA-N |
| XLogP | 1.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |