C12H23NO — CID 129150398
N-ethyl-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]propan-1-amine (PubChem CID 129150398) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-ethyl-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]propan-1-amine.
| Compound Name | N-ethyl-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 129150398 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-ethyl-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]propan-1-amine |
| SMILES | C=C(C)C(=C)OCCN(CC)CCC |
| InChI | InChI=1S/C12H23NO/c1-6-8-13(7-2)9-10-14-12(5)11(3)4/h3,5-10H2,1-2,4H3 |
| InChIKey | URHPWRLBTQSGPH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|