C12H24N2O — CID 88867284
N,N,N',N'-tetramethyl-2-(3-methylbuta-1,3-dien-2-yloxy)propane-1,3-diamine (PubChem CID 88867284) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N,N,N',N'-tetramethyl-2-(3-methylbuta-1,3-dien-2-yloxy)propane-1,3-diamine.
| Compound Name | N,N,N',N'-tetramethyl-2-(3-methylbuta-1,3-dien-2-yloxy)propane-1,3-diamine |
|---|---|
| PubChem CID | 88867284 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N,N,N',N'-tetramethyl-2-(3-methylbuta-1,3-dien-2-yloxy)propane-1,3-diamine |
| SMILES | C=C(C)C(=C)OC(CN(C)C)CN(C)C |
| InChI | InChI=1S/C12H24N2O/c1-10(2)11(3)15-12(8-13(4)5)9-14(6)7/h12H,1,3,8-9H2,2,4-7H3 |
| InChIKey | AORFYESOXMTJQG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|