C19H18ClF3N4O — CID 129152906
(4-anilino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)-[2-chloro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 129152906) has the molecular formula C19H18ClF3N4O and a molecular weight of 410.83 g/mol. Its IUPAC name is (4-anilino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)-[2-chloro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-anilino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129152906 |
| Molecular Formula | C19H18ClF3N4O |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (4-anilino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | NNC1=C(Nc2ccccc2)CCN(C(=O)c2cccc(C(F)(F)F)c2Cl)C1 |
| InChI | InChI=1S/C19H18ClF3N4O/c20-17-13(7-4-8-14(17)19(21,22)23)18(28)27-10-9-15(16(11-27)26-24)25-12-5-2-1-3-6-12/h1-8,25-26H,9-11,24H2 |
| InChIKey | XAGRUXIQXPKTOO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|