C12H11ClF3NO2 — CID 164892562
[2-chloro-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone (PubChem CID 164892562) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 164892562 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1Cl)N1CCOCC1 |
| InChI | InChI=1S/C12H11ClF3NO2/c13-10-8(2-1-3-9(10)12(14,15)16)11(18)17-4-6-19-7-5-17/h1-3H,4-7H2 |
| InChIKey | PTHJPISEXFEAIX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |