C17H15Cl2FN4O — CID 129152961
[5-amino-4-(pyridin-2-ylamino)-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichloro-4-fluorophenyl)methanone (PubChem CID 129152961) has the molecular formula C17H15Cl2FN4O and a molecular weight of 381.24 g/mol. Its IUPAC name is [5-amino-4-(pyridin-2-ylamino)-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichloro-4-fluorophenyl)methanone.
| Compound Name | [5-amino-4-(pyridin-2-ylamino)-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 129152961 |
| Molecular Formula | C17H15Cl2FN4O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [5-amino-4-(pyridin-2-ylamino)-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichloro-4-fluorophenyl)methanone |
| SMILES | NC1=C(Nc2ccccn2)CCN(C(=O)c2ccc(F)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C17H15Cl2FN4O/c18-15-10(4-5-11(20)16(15)19)17(25)24-8-6-13(12(21)9-24)23-14-3-1-2-7-22-14/h1-5,7H,6,8-9,21H2,(H,22,23) |
| InChIKey | DLFXKXVDZVKOBW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|