C16H18Cl2N6O — CID 129152966
[5-amino-4-[amino(1H-imidazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichlorophenyl)methanone (PubChem CID 129152966) has the molecular formula C16H18Cl2N6O and a molecular weight of 381.27 g/mol. Its IUPAC name is [5-amino-4-[amino(1H-imidazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichlorophenyl)methanone.
| Compound Name | [5-amino-4-[amino(1H-imidazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 129152966 |
| Molecular Formula | C16H18Cl2N6O |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [5-amino-4-[amino(1H-imidazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-(2,3-dichlorophenyl)methanone |
| SMILES | CC1C(N)=C(N(N)c2ncc[nH]2)CCN1C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2N6O/c1-9-14(19)12(24(20)16-21-6-7-22-16)5-8-23(9)15(25)10-3-2-4-11(17)13(10)18/h2-4,6-7,9H,5,8,19-20H2,1H3,(H,21,22) |
| InChIKey | HCOZDFOIMDTXHZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|