C17H17ClF3N5O2 — CID 129153138
[5-amino-4-[amino(1,3-oxazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 129153138) has the molecular formula C17H17ClF3N5O2 and a molecular weight of 415.80 g/mol. Its IUPAC name is [5-amino-4-[amino(1,3-oxazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-amino-4-[amino(1,3-oxazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129153138 |
| Molecular Formula | C17H17ClF3N5O2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [5-amino-4-[amino(1,3-oxazol-2-yl)amino]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1C(N)=C(N(N)c2ncco2)CCN1C(=O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C17H17ClF3N5O2/c1-9-14(22)12(26(23)16-24-6-8-28-16)5-7-25(9)15(27)10-3-2-4-11(13(10)18)17(19,20)21/h2-4,6,8-9H,5,7,22-23H2,1H3 |
| InChIKey | PRZOADVXWOAPQY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|