C17H18ClF3N6O — CID 129152838
[5-amino-4-[amino(1H-pyrazol-5-yl)amino]-2-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 129152838) has the molecular formula C17H18ClF3N6O and a molecular weight of 414.82 g/mol. Its IUPAC name is [5-amino-4-[amino(1H-pyrazol-5-yl)amino]-2-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-amino-4-[amino(1H-pyrazol-5-yl)amino]-2-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129152838 |
| Molecular Formula | C17H18ClF3N6O |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [5-amino-4-[amino(1H-pyrazol-5-yl)amino]-2-methyl-3,6-dihydro-2H-pyridin-1-yl]-[2-chloro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1CC(N(N)c2ccn[nH]2)=C(N)CN1C(=O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C17H18ClF3N6O/c1-9-7-13(27(23)14-5-6-24-25-14)12(22)8-26(9)16(28)10-3-2-4-11(15(10)18)17(19,20)21/h2-6,9H,7-8,22-23H2,1H3,(H,24,25) |
| InChIKey | SAXZFYMYMUSRJD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|