C18H18ClF3N6O — CID 163684841
[2-chloro-3-(trifluoromethyl)phenyl]-[2,6-dimethyl-1-(1H-pyrazol-5-yl)-3,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl]methanone (PubChem CID 163684841) has the molecular formula C18H18ClF3N6O and a molecular weight of 426.83 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[2,6-dimethyl-1-(1H-pyrazol-5-yl)-3,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[2,6-dimethyl-1-(1H-pyrazol-5-yl)-3,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 163684841 |
| Molecular Formula | C18H18ClF3N6O |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[2,6-dimethyl-1-(1H-pyrazol-5-yl)-3,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CC1CC2=C(CN1C(=O)c1cccc(C(F)(F)F)c1Cl)NN(C)N2c1ccn[nH]1 |
| InChI | InChI=1S/C18H18ClF3N6O/c1-10-8-14-13(25-26(2)28(14)15-6-7-23-24-15)9-27(10)17(29)11-4-3-5-12(16(11)19)18(20,21)22/h3-7,10,25H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | JNYKVVOOHBHTHI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |