C20H18ClF4N5O — CID 154023938
[2-chloro-3-(trifluoromethyl)phenyl]-[(2S)-4-[(5-fluoro-4-methyl-2-pyridinyl)imino]-3-hydrazinylidene-2-methylpiperidin-1-yl]methanone (PubChem CID 154023938) has the molecular formula C20H18ClF4N5O and a molecular weight of 455.84 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(2S)-4-[(5-fluoro-4-methyl-2-pyridinyl)imino]-3-hydrazinylidene-2-methylpiperidin-1-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(2S)-4-[(5-fluoro-4-methyl-2-pyridinyl)imino]-3-hydrazinylidene-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154023938 |
| Molecular Formula | C20H18ClF4N5O |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(2S)-4-[(5-fluoro-4-methyl-2-pyridinyl)imino]-3-hydrazinylidene-2-methylpiperidin-1-yl]methanone |
| SMILES | Cc1cc(/N=C2\CCN(C(=O)c3cccc(C(F)(F)F)c3Cl)[C@@H](C)C2=NN)ncc1F |
| InChI | InChI=1S/C20H18ClF4N5O/c1-10-8-16(27-9-14(10)22)28-15-6-7-30(11(2)18(15)29-26)19(31)12-4-3-5-13(17(12)21)20(23,24)25/h3-5,8-9,11H,6-7,26H2,1-2H3/b28-15+,29-18?/t11-/m0/s1 |
| InChIKey | SYTMFHXJXNBKAA-YRTQFZLWSA-N |
| XLogP | 4.52 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|