C20H14O — CID 129156170
12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18-nonaene (PubChem CID 129156170) has the molecular formula C20H14O and a molecular weight of 270.33 g/mol. Its IUPAC name is 12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18-nonaene.
| Compound Name | 12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18-nonaene |
|---|---|
| PubChem CID | 129156170 |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)CCc1c-2oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C20H14O/c1-3-7-15-13(5-1)9-11-17-18-12-10-14-6-2-4-8-16(14)20(18)21-19(15)17/h1-9,11H,10,12H2 |
| InChIKey | USDGYBDANVRBGZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |