C25H36N6O3 — CID 129156495
3-[4-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 129156495) has the molecular formula C25H36N6O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[4-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-[4-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 129156495 |
| Molecular Formula | C25H36N6O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 3-[4-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCCCC2)nc1Nc1ccc(C2CCN(CCOCCO)CC2)cc1 |
| InChI | InChI=1S/C25H36N6O3/c26-24(33)23-25(29-22(18-27-23)31-10-2-1-3-11-31)28-21-6-4-19(5-7-21)20-8-12-30(13-9-20)14-16-34-17-15-32/h4-7,18,20,32H,1-3,8-17H2,(H2,26,33)(H,28,29) |
| InChIKey | HWHRZZJLBXVKDH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|