C23H29N7O — CID 129156525
3-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 129156525) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 129156525 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | N#CCN1CCC(c2ccc(Nc3nc(N4CCCCC4)cnc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C23H29N7O/c24-10-15-29-13-8-18(9-14-29)17-4-6-19(7-5-17)27-23-21(22(25)31)26-16-20(28-23)30-11-2-1-3-12-30/h4-7,16,18H,1-3,8-9,11-15H2,(H2,25,31)(H,27,28) |
| InChIKey | NQIHGQRWJMWUOC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|