C8H15F2N — CID 129156684
(E)-1,3-difluoro-N,N-dimethylhex-3-en-1-amine (PubChem CID 129156684) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is (E)-1,3-difluoro-N,N-dimethylhex-3-en-1-amine.
| Compound Name | (E)-1,3-difluoro-N,N-dimethylhex-3-en-1-amine |
|---|---|
| PubChem CID | 129156684 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (E)-1,3-difluoro-N,N-dimethylhex-3-en-1-amine |
| SMILES | CC/C=C(/F)CC(F)N(C)C |
| InChI | InChI=1S/C8H15F2N/c1-4-5-7(9)6-8(10)11(2)3/h5,8H,4,6H2,1-3H3/b7-5+ |
| InChIKey | QBMCIBOMZYFARV-FNORWQNLSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|