C8H14FN — CID 127741808
5-fluoro-1-propyl-3,6-dihydro-2H-pyridine (PubChem CID 127741808) has the molecular formula C8H14FN and a molecular weight of 143.21 g/mol. Its IUPAC name is 5-fluoro-1-propyl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-fluoro-1-propyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 127741808 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-fluoro-1-propyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCN1CCC=C(F)C1 |
| InChI | InChI=1S/C8H14FN/c1-2-5-10-6-3-4-8(9)7-10/h4H,2-3,5-7H2,1H3 |
| InChIKey | KQJZMFYCSSUGQH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |