About 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid
3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid (PubChem CID 127007451) has the molecular formula C9H14FNO2
and a molecular weight of 187.21 g/mol. Its IUPAC name is 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid.
Analyze 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid (CID 127007451) is 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid is CC(CN1CCC=C(F)C1)C(=O)O.
What is the InChIKey of 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid?
The InChIKey is JUQUBSFBNORAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO2/c1-7(9(12)13)5-11-4-2-3-8(10)6-11/h3,7H,2,4-6H2,1H3,(H,12,13).
What are the key properties of 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid?
3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid has a molecular weight of 187.21 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-2-methylpropanoic acid is sourced from PubChem (CID 127007451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).