C9H13NO2 — CID 67895063
1-prop-2-enyl-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 67895063) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-prop-2-enyl-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-prop-2-enyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67895063 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-prop-2-enyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | C=CCN1CC=CC(C(=O)O)C1 |
| InChI | InChI=1S/C9H13NO2/c1-2-5-10-6-3-4-8(7-10)9(11)12/h2-4,8H,1,5-7H2,(H,11,12) |
| InChIKey | YOEGYJYCJMBSSM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|