C6H9NO2 — CID 5242131
1,2,3,6-tetrahydropyridine-3-carboxylic acid (PubChem CID 5242131) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridine-3-carboxylic acid.
| Compound Name | 1,2,3,6-tetrahydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 5242131 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1,2,3,6-tetrahydropyridine-3-carboxylic acid |
| SMILES | O=C(O)C1C=CCNC1 |
| InChI | InChI=1S/C6H9NO2/c8-6(9)5-2-1-3-7-4-5/h1-2,5,7H,3-4H2,(H,8,9) |
| InChIKey | OPSXYAFWJPPHQK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|