C9H14FNO2 — CID 130935353
3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)butanoic acid (PubChem CID 130935353) has the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. Its IUPAC name is 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)butanoic acid.
| Compound Name | 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 130935353 |
| Molecular Formula | C9H14FNO2 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)butanoic acid |
| SMILES | CC(CC(=O)O)N1CCC=C(F)C1 |
| InChI | InChI=1S/C9H14FNO2/c1-7(5-9(12)13)11-4-2-3-8(10)6-11/h3,7H,2,4-6H2,1H3,(H,12,13) |
| InChIKey | XMXCNJBRJYGLMA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |