C13H25N — CID 154954008
(5E)-1,5-dipropyl-3,4,7,8-tetrahydro-2H-azocine (PubChem CID 154954008) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (5E)-1,5-dipropyl-3,4,7,8-tetrahydro-2H-azocine.
| Compound Name | (5E)-1,5-dipropyl-3,4,7,8-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 154954008 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (5E)-1,5-dipropyl-3,4,7,8-tetrahydro-2H-azocine |
| SMILES | CCC/C1=C/CCN(CCC)CCC1 |
| InChI | InChI=1S/C13H25N/c1-3-7-13-8-5-11-14(10-4-2)12-6-9-13/h8H,3-7,9-12H2,1-2H3/b13-8- |
| InChIKey | ONUGUTSHETUZCC-JYRVWZFOSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|