C13H21N3O5 — CID 129156825
4-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoacetyl]amino]butanoic acid (PubChem CID 129156825) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoacetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 129156825 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoacetyl]amino]butanoic acid |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-9(2)11(19)14-7-4-8-16-13(21)12(20)15-6-3-5-10(17)18/h1,3-8H2,2H3,(H,14,19)(H,15,20)(H,16,21)(H,17,18) |
| InChIKey | RNZUPZNMVDYYEY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|