C32H47N3O2 — CID 129157094
(4Z,7Z,10Z,13Z,16Z,19Z)-N-methyl-N-[2-[[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienoyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 129157094) has the molecular formula C32H47N3O2 and a molecular weight of 505.75 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-methyl-N-[2-[[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienoyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-methyl-N-[2-[[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienoyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 129157094 |
| Molecular Formula | C32H47N3O2 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.37 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-methyl-N-[2-[[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienoyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | C=N/C=C\C=C(/C)C(=O)NCCN(C)C(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C32H47N3O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26-31(36)35(4)29-28-34-32(37)30(2)25-24-27-33-3/h6-7,9-10,12-13,15-16,18-19,21-22,24-25,27H,3,5,8,11,14,17,20,23,26,28-29H2,1-2,4H3,(H,34,37)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-,27-24-,30-25+ |
| InChIKey | QJFGTOUJYDAELW-VRESSPHOSA-N |
| XLogP | 7.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|