C30H48N2O3 — CID 86639146
tert-butyl N-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-methylamino]ethyl]carbamate (PubChem CID 86639146) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is tert-butyl N-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 86639146 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | tert-butyl N-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-methylamino]ethyl]carbamate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N(C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H48N2O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-28(33)32(5)27-26-31-29(34)35-30(2,3)4/h7-8,10-11,13-14,16-17,19-20,22-23H,6,9,12,15,18,21,24-27H2,1-5H3,(H,31,34)/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | LAPBLJWDDKGKEJ-XTJKPUCJSA-N |
| XLogP | 7.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|