C21H21F4NO — CID 129157432
N-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]phenyl]methyl]cyclopentanecarboxamide (PubChem CID 129157432) has the molecular formula C21H21F4NO and a molecular weight of 379.40 g/mol. Its IUPAC name is N-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]phenyl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]phenyl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 129157432 |
| Molecular Formula | C21H21F4NO |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]phenyl]methyl]cyclopentanecarboxamide |
| SMILES | O=C(NCc1cccc(-c2cc(CF)cc(C(F)(F)F)c2)c1)C1CCCC1 |
| InChI | InChI=1S/C21H21F4NO/c22-12-15-9-18(11-19(10-15)21(23,24)25)17-7-3-4-14(8-17)13-26-20(27)16-5-1-2-6-16/h3-4,7-11,16H,1-2,5-6,12-13H2,(H,26,27) |
| InChIKey | OAZHDFNDGWEANN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |