C19H17F7N2OSi — CID 162594944
(5R)-N-[[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-3-fluoro-1,3-azasilolidine-5-carboxamide (PubChem CID 162594944) has the molecular formula C19H17F7N2OSi and a molecular weight of 450.43 g/mol. Its IUPAC name is (5R)-N-[[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-3-fluoro-1,3-azasilolidine-5-carboxamide.
| Compound Name | (5R)-N-[[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-3-fluoro-1,3-azasilolidine-5-carboxamide |
|---|---|
| PubChem CID | 162594944 |
| Molecular Formula | C19H17F7N2OSi |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (5R)-N-[[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-3-fluoro-1,3-azasilolidine-5-carboxamide |
| SMILES | O=C(NCc1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1)[C@@H]1C[SiH](F)CN1 |
| InChI | InChI=1S/C19H17F7N2OSi/c20-18(21,22)14-5-13(6-15(7-14)19(23,24)25)12-3-1-2-11(4-12)8-27-17(29)16-9-30(26)10-28-16/h1-7,16,28,30H,8-10H2,(H,27,29)/t16-,30?/m0/s1 |
| InChIKey | MDVAJBUVKDJKGB-XSTXYMSBSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|