C19H18FNO3 — CID 166317989
3-[3-[[(3-fluorocyclobutanecarbonyl)amino]methyl]phenyl]benzoic acid (PubChem CID 166317989) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-[3-[[(3-fluorocyclobutanecarbonyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 3-[3-[[(3-fluorocyclobutanecarbonyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 166317989 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[3-[[(3-fluorocyclobutanecarbonyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(CNC(=O)C3CC(F)C3)c2)c1 |
| InChI | InChI=1S/C19H18FNO3/c20-17-9-16(10-17)18(22)21-11-12-3-1-4-13(7-12)14-5-2-6-15(8-14)19(23)24/h1-8,16-17H,9-11H2,(H,21,22)(H,23,24) |
| InChIKey | TVCNGHGBFABUTL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |