C25H25N3O5 — CID 129159161
(2S)-2-[[4-[2-[4-[[(2R)-oxolane-2-carbonyl]amino]phenyl]ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 129159161) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[4-[[(2R)-oxolane-2-carbonyl]amino]phenyl]ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-[[4-[2-[4-[[(2R)-oxolane-2-carbonyl]amino]phenyl]ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 129159161 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (2S)-2-[[4-[2-[4-[[(2R)-oxolane-2-carbonyl]amino]phenyl]ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(C#Cc2ccc(NC(=O)[C@@H]3CCCN3C(=O)O)cc2)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C25H25N3O5/c29-23(21-3-1-15-28(21)25(31)32)26-19-11-7-17(8-12-19)5-6-18-9-13-20(14-10-18)27-24(30)22-4-2-16-33-22/h7-14,21-22H,1-4,15-16H2,(H,26,29)(H,27,30)(H,31,32)/t21-,22+/m0/s1 |
| InChIKey | GINBEXFEXRPKTR-FCHUYYIVSA-N |
| XLogP | 3.28 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|