C24H24N2O — CID 129159339
N-[(3-cyclobutylphenyl)methyl]-2-(4-pyridin-4-ylphenyl)acetamide (PubChem CID 129159339) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(3-cyclobutylphenyl)methyl]-2-(4-pyridin-4-ylphenyl)acetamide.
| Compound Name | N-[(3-cyclobutylphenyl)methyl]-2-(4-pyridin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 129159339 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[(3-cyclobutylphenyl)methyl]-2-(4-pyridin-4-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccncc2)cc1)NCc1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C24H24N2O/c27-24(26-17-19-3-1-6-23(15-19)20-4-2-5-20)16-18-7-9-21(10-8-18)22-11-13-25-14-12-22/h1,3,6-15,20H,2,4-5,16-17H2,(H,26,27) |
| InChIKey | WEFLDBAMXDVJKP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |