C26H33F6N3O3 — CID 129159908
(3-methoxy-4-propan-2-yloxyphenyl)-[4-(2,2,2-trifluoroethyl)-15-(trifluoromethyl)-1,4,8-triazabicyclo[10.3.0]pentadeca-12,14-dien-8-yl]methanone (PubChem CID 129159908) has the molecular formula C26H33F6N3O3 and a molecular weight of 549.56 g/mol. Its IUPAC name is (3-methoxy-4-propan-2-yloxyphenyl)-[4-(2,2,2-trifluoroethyl)-15-(trifluoromethyl)-1,4,8-triazabicyclo[10.3.0]pentadeca-12,14-dien-8-yl]methanone.
| Compound Name | (3-methoxy-4-propan-2-yloxyphenyl)-[4-(2,2,2-trifluoroethyl)-15-(trifluoromethyl)-1,4,8-triazabicyclo[10.3.0]pentadeca-12,14-dien-8-yl]methanone |
|---|---|
| PubChem CID | 129159908 |
| Molecular Formula | C26H33F6N3O3 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | (3-methoxy-4-propan-2-yloxyphenyl)-[4-(2,2,2-trifluoroethyl)-15-(trifluoromethyl)-1,4,8-triazabicyclo[10.3.0]pentadeca-12,14-dien-8-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCCc3ccc(C(F)(F)F)n3CCN(CC(F)(F)F)CCC2)ccc1OC(C)C |
| InChI | InChI=1S/C26H33F6N3O3/c1-18(2)38-21-9-7-19(16-22(21)37-3)24(36)34-12-4-6-20-8-10-23(26(30,31)32)35(20)15-14-33(11-5-13-34)17-25(27,28)29/h7-10,16,18H,4-6,11-15,17H2,1-3H3 |
| InChIKey | QFVGTEUXDGVVMU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |