C25H24N4O2 — CID 129160122
1,5-dimethyl-4-[2-methyl-4-[[(2R)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one (PubChem CID 129160122) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,5-dimethyl-4-[2-methyl-4-[[(2R)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one.
| Compound Name | 1,5-dimethyl-4-[2-methyl-4-[[(2R)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one |
|---|---|
| PubChem CID | 129160122 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1,5-dimethyl-4-[2-methyl-4-[[(2R)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one |
| SMILES | Cc1ncc(-c2cc(=O)n(C)cc2C)c(OCC2C[C@H]2c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C25H24N4O2/c1-15-13-29(3)24(30)11-19(15)21-12-26-16(2)27-25(21)31-14-18-10-20(18)23-9-8-17-6-4-5-7-22(17)28-23/h4-9,11-13,18,20H,10,14H2,1-3H3/t18?,20-/m1/s1 |
| InChIKey | MHCKKOXXKKOVIW-ROPPNANJSA-N |
| XLogP | 4.19 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|