C7H11N3O2S — CID 129160773
1-[(3S)-2-oxopyrrolidin-3-yl]-3-(1-sulfanylethenyl)urea (PubChem CID 129160773) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-[(3S)-2-oxopyrrolidin-3-yl]-3-(1-sulfanylethenyl)urea.
| Compound Name | 1-[(3S)-2-oxopyrrolidin-3-yl]-3-(1-sulfanylethenyl)urea |
|---|---|
| PubChem CID | 129160773 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-[(3S)-2-oxopyrrolidin-3-yl]-3-(1-sulfanylethenyl)urea |
| SMILES | C=C(S)NC(=O)N[C@H]1CCNC1=O |
| InChI | InChI=1S/C7H11N3O2S/c1-4(13)9-7(12)10-5-2-3-8-6(5)11/h5,13H,1-3H2,(H,8,11)(H2,9,10,12)/t5-/m0/s1 |
| InChIKey | YJMPZFNFOULDIV-YFKPBYRVSA-N |
| XLogP | -0.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|