C7H11ClN2O2 — CID 164647044
2-chloro-N-(2-oxopyrrolidin-3-yl)propanamide (PubChem CID 164647044) has the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 2-chloro-N-(2-oxopyrrolidin-3-yl)propanamide.
| Compound Name | 2-chloro-N-(2-oxopyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 164647044 |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-chloro-N-(2-oxopyrrolidin-3-yl)propanamide |
| SMILES | CC(Cl)C(=O)NC1CCNC1=O |
| InChI | InChI=1S/C7H11ClN2O2/c1-4(8)6(11)10-5-2-3-9-7(5)12/h4-5H,2-3H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | MLLMHIYAGSURPR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|